C49H29F6N3OS2 — CID 102326403
2-[3-[2-(6-carbazol-9-yl-2-methyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-5-(4-phenylphenyl)-1,3,4-oxadiazole (PubChem CID 102326403) has the molecular formula C49H29F6N3OS2 and a molecular weight of 853.91 g/mol. Its IUPAC name is 2-[3-[2-(6-carbazol-9-yl-2-methyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-5-(4-phenylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[3-[2-(6-carbazol-9-yl-2-methyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-5-(4-phenylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102326403 |
| Molecular Formula | C49H29F6N3OS2 |
| Molecular Weight | 853.91 g/mol |
| Exact Mass | 853.17 |
| IUPAC Name | 2-[3-[2-(6-carbazol-9-yl-2-methyl-1-benzothiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-5-(4-phenylphenyl)-1,3,4-oxadiazole |
| SMILES | Cc1sc2cc(-c3nnc(-c4ccc(-c5ccccc5)cc4)o3)ccc2c1C1=C(c2c(C)sc3cc(-n4c5ccccc5c5ccccc54)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C49H29F6N3OS2/c1-26-41(35-22-20-31(24-39(35)60-26)46-57-56-45(59-46)30-18-16-29(17-19-30)28-10-4-3-5-11-28)43-44(48(52,53)49(54,55)47(43,50)51)42-27(2)61-40-25-32(21-23-36(40)42)58-37-14-8-6-12-33(37)34-13-7-9-15-38(34)58/h3-25H,1-2H3 |
| InChIKey | AJGGXFRFJQUFCJ-UHFFFAOYSA-N |
| XLogP | 15.04 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.91 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|