C12H5F4NO2S2 — CID 102330656
2-nitro-5-[(1E,3E)-1,2,3,4-tetrafluoro-4-thiophen-2-ylbuta-1,3-dienyl]thiophene (PubChem CID 102330656) has the molecular formula C12H5F4NO2S2 and a molecular weight of 335.30 g/mol. Its IUPAC name is 2-nitro-5-[(1E,3E)-1,2,3,4-tetrafluoro-4-thiophen-2-ylbuta-1,3-dienyl]thiophene.
| Compound Name | 2-nitro-5-[(1E,3E)-1,2,3,4-tetrafluoro-4-thiophen-2-ylbuta-1,3-dienyl]thiophene |
|---|---|
| PubChem CID | 102330656 |
| Molecular Formula | C12H5F4NO2S2 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 2-nitro-5-[(1E,3E)-1,2,3,4-tetrafluoro-4-thiophen-2-ylbuta-1,3-dienyl]thiophene |
| SMILES | O=[N+]([O-])c1ccc(/C(F)=C(F)/C(F)=C(\F)c2cccs2)s1 |
| InChI | InChI=1S/C12H5F4NO2S2/c13-9(6-2-1-5-20-6)11(15)12(16)10(14)7-3-4-8(21-7)17(18)19/h1-5H/b11-9+,12-10+ |
| InChIKey | PLUYPTUDXMAGHS-WGDLNXRISA-N |
| XLogP | 5.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|