C13H24F3N2O+ — CID 102331599
[(Z)-3-(diethylamino)-2-(2,2,2-trifluoroethoxy)prop-2-enylidene]-diethylazanium (PubChem CID 102331599) has the molecular formula C13H24F3N2O+ and a molecular weight of 281.34 g/mol. Its IUPAC name is [(Z)-3-(diethylamino)-2-(2,2,2-trifluoroethoxy)prop-2-enylidene]-diethylazanium.
| Compound Name | [(Z)-3-(diethylamino)-2-(2,2,2-trifluoroethoxy)prop-2-enylidene]-diethylazanium |
|---|---|
| PubChem CID | 102331599 |
| Molecular Formula | C13H24F3N2O+ |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | [(Z)-3-(diethylamino)-2-(2,2,2-trifluoroethoxy)prop-2-enylidene]-diethylazanium |
| SMILES | CCN(/C=C(/C=[N+](CC)CC)OCC(F)(F)F)CC |
| InChI | InChI=1S/C13H24F3N2O/c1-5-17(6-2)9-12(10-18(7-3)8-4)19-11-13(14,15)16/h9-10H,5-8,11H2,1-4H3/q+1 |
| InChIKey | PSRWXTXWEGVRJR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|