C23H27N5O4 — CID 102332635
3-[[(2,3-dimorpholin-4-ylquinoxalin-6-yl)amino]methyl]benzene-1,2-diol (PubChem CID 102332635) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-[[(2,3-dimorpholin-4-ylquinoxalin-6-yl)amino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[(2,3-dimorpholin-4-ylquinoxalin-6-yl)amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 102332635 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[[(2,3-dimorpholin-4-ylquinoxalin-6-yl)amino]methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CNc2ccc3nc(N4CCOCC4)c(N4CCOCC4)nc3c2)c1O |
| InChI | InChI=1S/C23H27N5O4/c29-20-3-1-2-16(21(20)30)15-24-17-4-5-18-19(14-17)26-23(28-8-12-32-13-9-28)22(25-18)27-6-10-31-11-7-27/h1-5,14,24,29-30H,6-13,15H2 |
| InChIKey | LKJIYYHYIJIFLM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|