C34H28N4O3 — CID 141412430
2,3-bis[3-[(2-hydroxyphenyl)methylamino]phenyl]quinoxalin-6-ol (PubChem CID 141412430) has the molecular formula C34H28N4O3 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2,3-bis[3-[(2-hydroxyphenyl)methylamino]phenyl]quinoxalin-6-ol.
| Compound Name | 2,3-bis[3-[(2-hydroxyphenyl)methylamino]phenyl]quinoxalin-6-ol |
|---|---|
| PubChem CID | 141412430 |
| Molecular Formula | C34H28N4O3 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 2,3-bis[3-[(2-hydroxyphenyl)methylamino]phenyl]quinoxalin-6-ol |
| SMILES | Oc1ccc2nc(-c3cccc(NCc4ccccc4O)c3)c(-c3cccc(NCc4ccccc4O)c3)nc2c1 |
| InChI | InChI=1S/C34H28N4O3/c39-28-15-16-29-30(19-28)38-34(23-10-6-12-27(18-23)36-21-25-8-2-4-14-32(25)41)33(37-29)22-9-5-11-26(17-22)35-20-24-7-1-3-13-31(24)40/h1-19,35-36,39-41H,20-21H2 |
| InChIKey | JKIVZXSDPRZFRQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|