C56H57NO2 — CID 102333543
1,3-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-5-tert-butyl-2-nitrobenzene (PubChem CID 102333543) has the molecular formula C56H57NO2 and a molecular weight of 776.08 g/mol. Its IUPAC name is 1,3-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-5-tert-butyl-2-nitrobenzene.
| Compound Name | 1,3-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-5-tert-butyl-2-nitrobenzene |
|---|---|
| PubChem CID | 102333543 |
| Molecular Formula | C56H57NO2 |
| Molecular Weight | 776.08 g/mol |
| Exact Mass | 775.44 |
| IUPAC Name | 1,3-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-5-tert-butyl-2-nitrobenzene |
| SMILES | Cc1cccc(C)c1-c1cccc(-c2c(C)cccc2C)c1Cc1cc(C(C)(C)C)cc(Cc2c(-c3c(C)cccc3C)cccc2-c2c(C)cccc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C56H57NO2/c1-34-18-12-19-35(2)51(34)45-26-16-27-46(52-36(3)20-13-21-37(52)4)49(45)32-42-30-44(56(9,10)11)31-43(55(42)57(58)59)33-50-47(53-38(5)22-14-23-39(53)6)28-17-29-48(50)54-40(7)24-15-25-41(54)8/h12-31H,32-33H2,1-11H3 |
| InChIKey | YYVBZAFCNINTIZ-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.08 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|