C23H34F3NO3 — CID 102335997
10-(1,3-benzodioxol-5-yl)-N,N-diethyl-12,12,12-trifluorododecanamide (PubChem CID 102335997) has the molecular formula C23H34F3NO3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-N,N-diethyl-12,12,12-trifluorododecanamide.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-N,N-diethyl-12,12,12-trifluorododecanamide |
|---|---|
| PubChem CID | 102335997 |
| Molecular Formula | C23H34F3NO3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-N,N-diethyl-12,12,12-trifluorododecanamide |
| SMILES | CCN(CC)C(=O)CCCCCCCCC(CC(F)(F)F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H34F3NO3/c1-3-27(4-2)22(28)12-10-8-6-5-7-9-11-19(16-23(24,25)26)18-13-14-20-21(15-18)30-17-29-20/h13-15,19H,3-12,16-17H2,1-2H3 |
| InChIKey | OVYAIEFOSDWJFZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|