C16H21ClO3 — CID 102048256
(4S)-4-(1,3-benzodioxol-5-yl)nonanoyl chloride (PubChem CID 102048256) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)nonanoyl chloride.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)nonanoyl chloride |
|---|---|
| PubChem CID | 102048256 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)nonanoyl chloride |
| SMILES | CCCCC[C@@H](CCC(=O)Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H21ClO3/c1-2-3-4-5-12(7-9-16(17)18)13-6-8-14-15(10-13)20-11-19-14/h6,8,10,12H,2-5,7,9,11H2,1H3/t12-/m0/s1 |
| InChIKey | UXFGMRSCIWMQEY-LBPRGKRZSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|