C21H24O3 — CID 154714518
1-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)heptan-3-one (PubChem CID 154714518) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)heptan-3-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)heptan-3-one |
|---|---|
| PubChem CID | 154714518 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)heptan-3-one |
| SMILES | CCCCC(=O)CC(c1ccc(C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H24O3/c1-3-4-5-18(22)13-19(16-8-6-15(2)7-9-16)17-10-11-20-21(12-17)24-14-23-20/h6-12,19H,3-5,13-14H2,1-2H3 |
| InChIKey | ZMVCRDJYPJDSLF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |