About CID 102336244
CID 102336244 (PubChem CID 102336244) has the molecular formula C39H54BN6S3+3
and a molecular weight of 713.92 g/mol.
Molecular Properties
| Compound Name | CID 102336244 |
| PubChem CID | 102336244 |
| Molecular Formula | C39H54BN6S3+3 |
| Molecular Weight | 713.92 g/mol |
| Exact Mass | 713.36 |
| IUPAC Name | — |
| SMILES | SC1=[N+](C23CC4CC(CC(C4)C2)C3)C=C[N+]1[B-]([n+]1ccn(C23CC4CC(CC(C4)C2)C3)c1S)[n+]1ccn(C23CC4CC(CC(C4)C2)C3)c1S |
| InChI | InChI=1S/C39H51BN6S3/c47-34-41(37-16-25-7-26(17-37)9-27(8-25)18-37)1-4-44(34)40(45-5-2-42(35(45)48)38-19-28-10-29(20-38)12-30(11-28)21-38)46-6-3-43(36(46)49)39-22-31-13-32(23-39)15-33(14-31)24-39/h1-6,25-33H,7-24H2/p+3 |
| InChIKey | FRJXWKPKQDWHNT-UHFFFAOYSA-Q |
| XLogP | 6.57 |
| TPSA | 26.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 713.92 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 102336244 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102336244?
The IUPAC name of CID 102336244 (CID 102336244) is not available.
What is the SMILES notation for CID 102336244?
The canonical SMILES for CID 102336244 is SC1=[N+](C23CC4CC(CC(C4)C2)C3)C=C[N+]1[B-]([n+]1ccn(C23CC4CC(CC(C4)C2)C3)c1S)[n+]1ccn(C23CC4CC(CC(C4)C2)C3)c1S.
What is the InChIKey of CID 102336244?
The InChIKey is FRJXWKPKQDWHNT-UHFFFAOYSA-Q. The full InChI is InChI=1S/C39H51BN6S3/c47-34-41(37-16-25-7-26(17-37)9-27(8-25)18-37)1-4-44(34)40(45-5-2-42(35(45)48)38-19-28-10-29(20-38)12-30(11-28)21-38)46-6-3-43(36(46)49)39-22-31-13-32(23-39)15-33(14-31)24-39/h1-6,25-33H,7-24H2/p+3.
What are the key properties of CID 102336244?
CID 102336244 has a molecular weight of 713.92 g/mol, XLogP of 6.57, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102336244 is sourced from PubChem (CID 102336244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).