methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate

C15H18O6 — CID 102337545

IUPACmethyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate
SMILESC=C(C(=O)OC)C(OC(C)=O)c1ccc(OC)c(OC)c1
InChIInChI=1S/C15H18O6/c1-9(15(17)20-5)14(21-10(2)16)11-6-7-12(18-3)13(8-11)19-4/h6-8,14H,1H2,2-5H3
InChIKeyLOFXEGNOSJGUEZ-UHFFFAOYSA-N
MW294.30 g/mol
LogP2.04
Rot. Bonds6

About methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate

methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate (PubChem CID 102337545) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate
PubChem CID102337545
Molecular FormulaC15H18O6
Molecular Weight294.30 g/mol
Exact Mass294.11
IUPAC Namemethyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate
SMILESC=C(C(=O)OC)C(OC(C)=O)c1ccc(OC)c(OC)c1
InChIInChI=1S/C15H18O6/c1-9(15(17)20-5)14(21-10(2)16)11-6-7-12(18-3)13(8-11)19-4/h6-8,14H,1H2,2-5H3
InChIKeyLOFXEGNOSJGUEZ-UHFFFAOYSA-N
XLogP2.04
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.30
LogP ≤ 52.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate?
The IUPAC name of methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate (CID 102337545) is methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate?
The canonical SMILES for methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate is C=C(C(=O)OC)C(OC(C)=O)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate?
The InChIKey is LOFXEGNOSJGUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O6/c1-9(15(17)20-5)14(21-10(2)16)11-6-7-12(18-3)13(8-11)19-4/h6-8,14H,1H2,2-5H3.
What are the key properties of methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate?
methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate has a molecular weight of 294.30 g/mol, XLogP of 2.04, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[acetyloxy-(3,4-dimethoxyphenyl)methyl]prop-2-enoate is sourced from PubChem (CID 102337545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).