C14H13ClF2O5 — CID 129247958
methyl 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoate (PubChem CID 129247958) has the molecular formula C14H13ClF2O5 and a molecular weight of 334.70 g/mol. Its IUPAC name is methyl 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoate.
| Compound Name | methyl 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 129247958 |
| Molecular Formula | C14H13ClF2O5 |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | methyl 2-[acetyloxy-[3-chloro-4-(difluoromethoxy)phenyl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(OC(C)=O)c1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClF2O5/c1-7(13(19)20-3)12(21-8(2)18)9-4-5-11(10(15)6-9)22-14(16)17/h4-6,12,14H,1H2,2-3H3 |
| InChIKey | WEANMXIVMBHKRI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|