C13H14N4O5 — CID 102339471
dimethyl 6-amino-5-cyano-3-ethyl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate (PubChem CID 102339471) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-3-ethyl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-3-ethyl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 102339471 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | dimethyl 6-amino-5-cyano-3-ethyl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate |
| SMILES | CCc1[nH]nc2c1C(C(=O)OC)(C(=O)OC)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C13H14N4O5/c1-4-7-8-10(17-16-7)22-9(15)6(5-14)13(8,11(18)20-2)12(19)21-3/h4,15H2,1-3H3,(H,16,17) |
| InChIKey | FREWTAKTRKKTCA-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|