C14H16N4O5 — CID 102339473
dimethyl 6-amino-5-cyano-3-propan-2-yl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate (PubChem CID 102339473) has the molecular formula C14H16N4O5 and a molecular weight of 320.31 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-3-propan-2-yl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-3-propan-2-yl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 102339473 |
| Molecular Formula | C14H16N4O5 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | dimethyl 6-amino-5-cyano-3-propan-2-yl-2H-pyrano[2,3-c]pyrazole-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C#N)=C(N)Oc2n[nH]c(C(C)C)c21 |
| InChI | InChI=1S/C14H16N4O5/c1-6(2)9-8-11(18-17-9)23-10(16)7(5-15)14(8,12(19)21-3)13(20)22-4/h6H,16H2,1-4H3,(H,17,18) |
| InChIKey | WEGGSBPFYOLEPZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|