C26H18Cl2N4O6S2 — CID 102339690
N-[2-[[2-(benzoylsulfamoyl)-4-chlorophenyl]diazenyl]-5-chlorophenyl]sulfonylbenzamide (PubChem CID 102339690) has the molecular formula C26H18Cl2N4O6S2 and a molecular weight of 617.49 g/mol. Its IUPAC name is N-[2-[[2-(benzoylsulfamoyl)-4-chlorophenyl]diazenyl]-5-chlorophenyl]sulfonylbenzamide.
| Compound Name | N-[2-[[2-(benzoylsulfamoyl)-4-chlorophenyl]diazenyl]-5-chlorophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 102339690 |
| Molecular Formula | C26H18Cl2N4O6S2 |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 616.00 |
| IUPAC Name | N-[2-[[2-(benzoylsulfamoyl)-4-chlorophenyl]diazenyl]-5-chlorophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1cc(Cl)ccc1/N=N/c1ccc(Cl)cc1S(=O)(=O)NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H18Cl2N4O6S2/c27-19-11-13-21(23(15-19)39(35,36)31-25(33)17-7-3-1-4-8-17)29-30-22-14-12-20(28)16-24(22)40(37,38)32-26(34)18-9-5-2-6-10-18/h1-16H,(H,31,33)(H,32,34)/b30-29+ |
| InChIKey | LYWPWXGOFJBWLE-QVIHXGFCSA-N |
| XLogP | 5.65 |
| TPSA | 151.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|