C19H36O5Si — CID 102340540
trans-ethyl (1R,2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(ethoxymethoxy)but-3-enyl]cyclopropane-1-carboxylate (PubChem CID 102340540) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(ethoxymethoxy)but-3-enyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(ethoxymethoxy)but-3-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102340540 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | trans-ethyl (1R,2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(ethoxymethoxy)but-3-enyl]cyclopropane-1-carboxylate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OCOCC)[C@@H]1C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C19H36O5Si/c1-9-16(24-25(7,8)19(4,5)6)17(23-13-21-10-2)14-12-15(14)18(20)22-11-3/h9,14-17H,1,10-13H2,2-8H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | QRDLDAFPXCCZFW-QBPKDAKJSA-N |
| XLogP | 4.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|