C21H34N2O4 — CID 102342894
methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-3-methyl-1-oxopentan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate (PubChem CID 102342894) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-3-methyl-1-oxopentan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-3-methyl-1-oxopentan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102342894 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | methyl (2R,3S,3aS,7aS)-4-[(2R)-1-(tert-butylamino)-3-methyl-1-oxopentan-2-yl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3-carboxylate |
| SMILES | C=C[C@H]1O[C@H]2C=CCN([C@@H](C(=O)NC(C)(C)C)C(C)CC)[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C21H34N2O4/c1-8-13(3)17(19(24)22-21(4,5)6)23-12-10-11-15-18(23)16(20(25)26-7)14(9-2)27-15/h9-11,13-18H,2,8,12H2,1,3-7H3,(H,22,24)/t13?,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | HBSBXLITZCOEOG-PXDPFURRSA-N |
| XLogP | 2.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|