C37H37NO6 — CID 102343068
trityl N-[2-[1-(hydroxymethyl)-4-methoxy-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl]-N-methylcarbamate (PubChem CID 102343068) has the molecular formula C37H37NO6 and a molecular weight of 591.70 g/mol. Its IUPAC name is trityl N-[2-[1-(hydroxymethyl)-4-methoxy-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl]-N-methylcarbamate.
| Compound Name | trityl N-[2-[1-(hydroxymethyl)-4-methoxy-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 102343068 |
| Molecular Formula | C37H37NO6 |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | trityl N-[2-[1-(hydroxymethyl)-4-methoxy-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl]-N-methylcarbamate |
| SMILES | COc1ccc(CO)c2c1OC1CCCC(=O)C21CCN(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H37NO6/c1-38(24-23-36-31(40)19-12-20-32(36)43-34-30(42-2)22-21-26(25-39)33(34)36)35(41)44-37(27-13-6-3-7-14-27,28-15-8-4-9-16-28)29-17-10-5-11-18-29/h3-11,13-18,21-22,32,39H,12,19-20,23-25H2,1-2H3 |
| InChIKey | YMLWXOJNOWPJCW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|