C27H37NO6 — CID 118975177
cyclohexyl [2-[(8S,12R,13S)-2-methoxy-7-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-13-yl]ethyl-methylamino]methyl carbonate (PubChem CID 118975177) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is cyclohexyl [2-[(8S,12R,13S)-2-methoxy-7-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-13-yl]ethyl-methylamino]methyl carbonate.
| Compound Name | cyclohexyl [2-[(8S,12R,13S)-2-methoxy-7-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-13-yl]ethyl-methylamino]methyl carbonate |
|---|---|
| PubChem CID | 118975177 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | cyclohexyl [2-[(8S,12R,13S)-2-methoxy-7-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-13-yl]ethyl-methylamino]methyl carbonate |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@H](C(C)C2)[C@@]31CCN(C)COC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C27H37NO6/c1-17-15-18-9-12-22(31-3)24-23(18)27(20(17)10-11-21(29)25(27)34-24)13-14-28(2)16-32-26(30)33-19-7-5-4-6-8-19/h9,12,17,19-20,25H,4-8,10-11,13-16H2,1-3H3/t17?,20-,25-,27-/m0/s1 |
| InChIKey | HHZXWZRGFDEGDY-IACPUMTKSA-N |
| XLogP | 4.63 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|