C25H37NO8Si — CID 154793184
2-[(5aS,6S,9aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-(2-nitroethyl)-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl acetate (PubChem CID 154793184) has the molecular formula C25H37NO8Si and a molecular weight of 507.66 g/mol. Its IUPAC name is 2-[(5aS,6S,9aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-(2-nitroethyl)-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl acetate.
| Compound Name | 2-[(5aS,6S,9aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-(2-nitroethyl)-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl acetate |
|---|---|
| PubChem CID | 154793184 |
| Molecular Formula | C25H37NO8Si |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-[(5aS,6S,9aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-1-(2-nitroethyl)-9-oxo-5a,6,7,8-tetrahydrodibenzofuran-9a-yl]ethyl acetate |
| SMILES | COc1ccc(CC[N+](=O)[O-])c2c1O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)[C@]21CCOC(C)=O |
| InChI | InChI=1S/C25H37NO8Si/c1-16(27)32-15-13-25-20(28)11-10-19(34-35(6,7)24(2,3)4)23(25)33-22-18(31-5)9-8-17(21(22)25)12-14-26(29)30/h8-9,19,23H,10-15H2,1-7H3/t19-,23+,25+/m0/s1 |
| InChIKey | YKCKIVOKKMOGNK-DNVKUUNQSA-N |
| XLogP | 4.22 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|