C27H46O4Si2 — CID 11352338
[(5aS,9aS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6,7-dihydro-5aH-dibenzofuran-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11352338) has the molecular formula C27H46O4Si2 and a molecular weight of 490.83 g/mol. Its IUPAC name is [(5aS,9aS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6,7-dihydro-5aH-dibenzofuran-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(5aS,9aS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6,7-dihydro-5aH-dibenzofuran-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11352338 |
| Molecular Formula | C27H46O4Si2 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [(5aS,9aS)-9a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-6,7-dihydro-5aH-dibenzofuran-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(CO[Si](C)(C)C(C)(C)C)c2c1O[C@H]1CCC=C[C@@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O4Si2/c1-25(2,3)32(8,9)29-18-20-15-16-21(28-7)24-23(20)27(17-13-12-14-22(27)31-24)19-30-33(10,11)26(4,5)6/h13,15-17,22H,12,14,18-19H2,1-11H3/t22-,27-/m0/s1 |
| InChIKey | MHPYWWMDYGURTR-CUNXSJBXSA-N |
| XLogP | 7.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|