C22H34O4Si — CID 11200139
[(3S,4aS,9bR)-6-methoxy-9b-[(Z)-2-methoxyethenyl]-2,3,4,4a-tetrahydro-1H-dibenzofuran-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11200139) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is [(3S,4aS,9bR)-6-methoxy-9b-[(Z)-2-methoxyethenyl]-2,3,4,4a-tetrahydro-1H-dibenzofuran-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,4aS,9bR)-6-methoxy-9b-[(Z)-2-methoxyethenyl]-2,3,4,4a-tetrahydro-1H-dibenzofuran-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11200139 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(3S,4aS,9bR)-6-methoxy-9b-[(Z)-2-methoxyethenyl]-2,3,4,4a-tetrahydro-1H-dibenzofuran-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO/C=C\[C@@]12CC[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1Oc1c(OC)cccc12 |
| InChI | InChI=1S/C22H34O4Si/c1-21(2,3)27(6,7)26-16-11-12-22(13-14-23-4)17-9-8-10-18(24-5)20(17)25-19(22)15-16/h8-10,13-14,16,19H,11-12,15H2,1-7H3/b14-13-/t16-,19-,22+/m0/s1 |
| InChIKey | CKFYHXGGECUQDM-MLEHHCMYSA-N |
| XLogP | 5.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|