C20H32O3Si — CID 158416039
[(1S,2R,3aS,8bS)-5-methoxy-2-methyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 158416039) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is [(1S,2R,3aS,8bS)-5-methoxy-2-methyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2R,3aS,8bS)-5-methoxy-2-methyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 158416039 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(1S,2R,3aS,8bS)-5-methoxy-2-methyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COc1cccc2c1O[C@H]1C[C@@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C20H32O3Si/c1-13-11-17-18(14-9-8-10-16(21-5)19(14)23-17)15(13)12-22-24(6,7)20(2,3)4/h8-10,13,15,17-18H,11-12H2,1-7H3/t13-,15+,17+,18-/m1/s1 |
| InChIKey | WQAAMIYKLRLGSJ-HUHSQHJXSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|