C22H34O5Si — CID 154429211
methyl 3-[(1S,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]propanoate (PubChem CID 154429211) has the molecular formula C22H34O5Si and a molecular weight of 406.60 g/mol. Its IUPAC name is methyl 3-[(1S,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]propanoate.
| Compound Name | methyl 3-[(1S,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]propanoate |
|---|---|
| PubChem CID | 154429211 |
| Molecular Formula | C22H34O5Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | methyl 3-[(1S,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]propanoate |
| SMILES | COC(=O)CCc1cccc2c1O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)[C@@H]21 |
| InChI | InChI=1S/C22H34O5Si/c1-22(2,3)28(5,6)27-17-12-18-20(16(17)13-23)15-9-7-8-14(21(15)26-18)10-11-19(24)25-4/h7-9,16-18,20,23H,10-13H2,1-6H3/t16-,17+,18-,20+/m0/s1 |
| InChIKey | KWBPJTPKRXIMOP-HLNWXESRSA-N |
| XLogP | 4.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|