C31H46O4Si — CID 163681933
4-[(1R,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(E,3S,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid (PubChem CID 163681933) has the molecular formula C31H46O4Si and a molecular weight of 510.79 g/mol. Its IUPAC name is 4-[(1R,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(E,3S,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid.
| Compound Name | 4-[(1R,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(E,3S,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid |
|---|---|
| PubChem CID | 163681933 |
| Molecular Formula | C31H46O4Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | 4-[(1R,2R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(E,3S,4S)-3,4-dimethyloct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid |
| SMILES | CC#CC[C@H](C)[C@H](C)/C=C/[C@@H]1[C@H]2c3cccc(CCCC(=O)O)c3O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H46O4Si/c1-9-10-13-21(2)22(3)18-19-24-26(35-36(7,8)31(4,5)6)20-27-29(24)25-16-11-14-23(30(25)34-27)15-12-17-28(32)33/h11,14,16,18-19,21-22,24,26-27,29H,12-13,15,17,20H2,1-8H3,(H,32,33)/b19-18+/t21-,22+,24-,26+,27-,29-/m0/s1 |
| InChIKey | SMZCIRKNPDYPOU-OMCQIAPMSA-N |
| XLogP | 7.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|