C17H20O4 — CID 145379608
methyl 4-[(3aS,8bS)-1-formyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate (PubChem CID 145379608) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl 4-[(3aS,8bS)-1-formyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate.
| Compound Name | methyl 4-[(3aS,8bS)-1-formyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
|---|---|
| PubChem CID | 145379608 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methyl 4-[(3aS,8bS)-1-formyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
| SMILES | COC(=O)CCCc1cccc2c1O[C@H]1CCC(C=O)[C@@H]21 |
| InChI | InChI=1S/C17H20O4/c1-20-15(19)7-3-5-11-4-2-6-13-16-12(10-18)8-9-14(16)21-17(11)13/h2,4,6,10,12,14,16H,3,5,7-9H2,1H3/t12?,14-,16-/m0/s1 |
| InChIKey | DNTWTWYBXAURAI-DBQWNMKUSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|