C28H28O6 — CID 67832531
[(3aR,8bR)-1-(hydroxymethyl)-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-yl] naphthalene-2-carboxylate (PubChem CID 67832531) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(3aR,8bR)-1-(hydroxymethyl)-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-yl] naphthalene-2-carboxylate.
| Compound Name | [(3aR,8bR)-1-(hydroxymethyl)-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 67832531 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [(3aR,8bR)-1-(hydroxymethyl)-5-(4-methoxy-4-oxobutyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-yl] naphthalene-2-carboxylate |
| SMILES | COC(=O)CCCc1ccc(OC(=O)c2ccc3ccccc3c2)c2c1O[C@@H]1CCC(CO)[C@H]21 |
| InChI | InChI=1S/C28H28O6/c1-32-24(30)8-4-7-18-11-13-23(26-25-21(16-29)12-14-22(25)33-27(18)26)34-28(31)20-10-9-17-5-2-3-6-19(17)15-20/h2-3,5-6,9-11,13,15,21-22,25,29H,4,7-8,12,14,16H2,1H3/t21?,22-,25+/m1/s1 |
| InChIKey | QGTQUNNPJBMQNV-YZZQRFRASA-N |
| XLogP | 4.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|