C31H44O5Si — CID 71134766
methyl 4-[(1R,2S,3aS,8bS)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-[(E,4S)-4-methyl-3-oxooct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate (PubChem CID 71134766) has the molecular formula C31H44O5Si and a molecular weight of 524.77 g/mol. Its IUPAC name is methyl 4-[(1R,2S,3aS,8bS)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-[(E,4S)-4-methyl-3-oxooct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate.
| Compound Name | methyl 4-[(1R,2S,3aS,8bS)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-[(E,4S)-4-methyl-3-oxooct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
|---|---|
| PubChem CID | 71134766 |
| Molecular Formula | C31H44O5Si |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | methyl 4-[(1R,2S,3aS,8bS)-2-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-1-[(E,4S)-4-methyl-3-oxooct-1-en-6-ynyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoate |
| SMILES | CC#CC[C@H](C)C(=O)/C=C/[C@H]1[C@H](CC(C)(C)[Si](C)(C)O)C[C@@H]2Oc3c(CCCC(=O)OC)cccc3[C@H]12 |
| InChI | InChI=1S/C31H44O5Si/c1-8-9-12-21(2)26(32)18-17-24-23(20-31(3,4)37(6,7)34)19-27-29(24)25-15-10-13-22(30(25)36-27)14-11-16-28(33)35-5/h10,13,15,17-18,21,23-24,27,29,34H,11-12,14,16,19-20H2,1-7H3/b18-17+/t21-,23-,24-,27-,29-/m0/s1 |
| InChIKey | BTAKLMFMRULIKM-SVPXTELLSA-N |
| XLogP | 6.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|