C23H30O2 — CID 155258442
(E)-1-(5-butyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl)oct-1-en-6-yn-3-ol (PubChem CID 155258442) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (E)-1-(5-butyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl)oct-1-en-6-yn-3-ol.
| Compound Name | (E)-1-(5-butyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl)oct-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 155258442 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (E)-1-(5-butyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl)oct-1-en-6-yn-3-ol |
| SMILES | CC#CCCC(O)/C=C/C1CCC2Oc3c(CCCC)cccc3C12 |
| InChI | InChI=1S/C23H30O2/c1-3-5-7-11-19(24)15-13-17-14-16-21-22(17)20-12-8-10-18(9-6-4-2)23(20)25-21/h8,10,12-13,15,17,19,21-22,24H,4,6-7,9,11,14,16H2,1-2H3/b15-13+ |
| InChIKey | HVAAHTGPRURBIK-FYWRMAATSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|