C18H20O2 — CID 155258430
(E)-1-[(1R)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]hept-1-en-6-yn-3-ol (PubChem CID 155258430) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (E)-1-[(1R)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]hept-1-en-6-yn-3-ol.
| Compound Name | (E)-1-[(1R)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]hept-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 155258430 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (E)-1-[(1R)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-yl]hept-1-en-6-yn-3-ol |
| SMILES | C#CCCC(O)/C=C/[C@H]1CCC2Oc3ccccc3C21 |
| InChI | InChI=1S/C18H20O2/c1-2-3-6-14(19)11-9-13-10-12-17-18(13)15-7-4-5-8-16(15)20-17/h1,4-5,7-9,11,13-14,17-19H,3,6,10,12H2/b11-9+/t13-,14?,17?,18?/m0/s1 |
| InChIKey | ANVHVXMZFGQVCD-YDQXFLPVSA-N |
| XLogP | 3.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|