C26H36O8Si — CID 138969935
2-[(1S,2S,5R,9S,17R)-2-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7-oxo-6,8,18-trioxapentacyclo[13.2.1.05,9.05,17.011,16]octadeca-11(16),12,14-trien-17-yl]ethyl acetate (PubChem CID 138969935) has the molecular formula C26H36O8Si and a molecular weight of 504.65 g/mol. Its IUPAC name is 2-[(1S,2S,5R,9S,17R)-2-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7-oxo-6,8,18-trioxapentacyclo[13.2.1.05,9.05,17.011,16]octadeca-11(16),12,14-trien-17-yl]ethyl acetate.
| Compound Name | 2-[(1S,2S,5R,9S,17R)-2-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7-oxo-6,8,18-trioxapentacyclo[13.2.1.05,9.05,17.011,16]octadeca-11(16),12,14-trien-17-yl]ethyl acetate |
|---|---|
| PubChem CID | 138969935 |
| Molecular Formula | C26H36O8Si |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-[(1S,2S,5R,9S,17R)-2-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-7-oxo-6,8,18-trioxapentacyclo[13.2.1.05,9.05,17.011,16]octadeca-11(16),12,14-trien-17-yl]ethyl acetate |
| SMILES | COc1ccc2c3c1O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]4(OC(=O)O[C@H]4C2)[C@]31CCOC(C)=O |
| InChI | InChI=1S/C26H36O8Si/c1-15(27)30-13-12-25-20-16-8-9-17(29-5)21(20)32-22(25)18(34-35(6,7)24(2,3)4)10-11-26(25)19(14-16)31-23(28)33-26/h8-9,18-19,22H,10-14H2,1-7H3/t18-,19-,22+,25+,26-/m0/s1 |
| InChIKey | KZTVSLROGDKNFK-YBDXXGANSA-N |
| XLogP | 4.66 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|