C17H18O5 — CID 102185626
[(3R,4aS,9bS)-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-3H-dibenzofuran-3-yl] acetate (PubChem CID 102185626) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(3R,4aS,9bS)-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-3H-dibenzofuran-3-yl] acetate.
| Compound Name | [(3R,4aS,9bS)-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-3H-dibenzofuran-3-yl] acetate |
|---|---|
| PubChem CID | 102185626 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [(3R,4aS,9bS)-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-3H-dibenzofuran-3-yl] acetate |
| SMILES | COc1cccc2c1O[C@H]1C[C@@H](OC(C)=O)C=C[C@@]21CC=O |
| InChI | InChI=1S/C17H18O5/c1-11(19)21-12-6-7-17(8-9-18)13-4-3-5-14(20-2)16(13)22-15(17)10-12/h3-7,9,12,15H,8,10H2,1-2H3/t12-,15-,17+/m0/s1 |
| InChIKey | OKFUYGUWROIYBT-YLQAJVPDSA-N |
| XLogP | 2.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|