C23H32O5Si — CID 71540326
2-[(1R,4S,4aR,9bS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-1H-dibenzofuran-1-yl]acetaldehyde (PubChem CID 71540326) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[(1R,4S,4aR,9bS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-1H-dibenzofuran-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,4S,4aR,9bS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-1H-dibenzofuran-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 71540326 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[(1R,4S,4aR,9bS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-9b-(2-oxoethyl)-4,4a-dihydro-1H-dibenzofuran-1-yl]acetaldehyde |
| SMILES | COc1cccc2c1O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C[C@@H](CC=O)[C@@]21CC=O |
| InChI | InChI=1S/C23H32O5Si/c1-22(2,3)29(5,6)28-19-11-10-16(12-14-24)23(13-15-25)17-8-7-9-18(26-4)20(17)27-21(19)23/h7-11,14-16,19,21H,12-13H2,1-6H3/t16-,19-,21-,23-/m0/s1 |
| InChIKey | GYVFZFBGGPXLBF-OXKOKHSUSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|