C28H39NO5Si — CID 23244316
methyl (E)-3-[(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate (PubChem CID 23244316) has the molecular formula C28H39NO5Si and a molecular weight of 497.71 g/mol. Its IUPAC name is methyl (E)-3-[(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate |
|---|---|
| PubChem CID | 23244316 |
| Molecular Formula | C28H39NO5Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | methyl (E)-3-[(4R,4aS,7S,7aR,12bS)-7-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(OC)c2c3c1C[C@@H]1[C@H]4C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O2)[C@]34CCN1C |
| InChI | InChI=1S/C28H39NO5Si/c1-27(2,3)35(7,8)34-21-11-10-19-20-16-18-17(9-12-23(30)32-6)15-22(31-5)25-24(18)28(19,26(21)33-25)13-14-29(20)4/h9-12,15,19-21,26H,13-14,16H2,1-8H3/b12-9+/t19-,20-,21+,26+,28+/m1/s1 |
| InChIKey | UHXXBBPECNAMKU-XJTNRYMBSA-N |
| XLogP | 4.72 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|