C20H22O7 — CID 10499634
methyl 2-[(8S,11R,12S,13R)-2-methoxy-11-(methoxymethoxy)-7-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraen-13-yl]acetate (PubChem CID 10499634) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl 2-[(8S,11R,12S,13R)-2-methoxy-11-(methoxymethoxy)-7-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraen-13-yl]acetate.
| Compound Name | methyl 2-[(8S,11R,12S,13R)-2-methoxy-11-(methoxymethoxy)-7-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraen-13-yl]acetate |
|---|---|
| PubChem CID | 10499634 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 2-[(8S,11R,12S,13R)-2-methoxy-11-(methoxymethoxy)-7-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),9-tetraen-13-yl]acetate |
| SMILES | COCO[C@@H]1C=C[C@@H]2C(=O)Cc3ccc(OC)c4c3[C@]2(CC(=O)OC)[C@@H]1O4 |
| InChI | InChI=1S/C20H22O7/c1-23-10-26-15-7-5-12-13(21)8-11-4-6-14(24-2)18-17(11)20(12,19(15)27-18)9-16(22)25-3/h4-7,12,15,19H,8-10H2,1-3H3/t12-,15-,19-,20-/m1/s1 |
| InChIKey | IBHPRJHKUUGUPG-DDAIWRKXSA-N |
| XLogP | 1.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|