C18H19BrO7 — CID 46217920
methyl (5aS,7S,9aR)-8-bromo-1-formyl-4-methoxy-7-(methoxymethoxy)-6,7-dihydro-5aH-dibenzofuran-9a-carboxylate (PubChem CID 46217920) has the molecular formula C18H19BrO7 and a molecular weight of 427.25 g/mol. Its IUPAC name is methyl (5aS,7S,9aR)-8-bromo-1-formyl-4-methoxy-7-(methoxymethoxy)-6,7-dihydro-5aH-dibenzofuran-9a-carboxylate.
| Compound Name | methyl (5aS,7S,9aR)-8-bromo-1-formyl-4-methoxy-7-(methoxymethoxy)-6,7-dihydro-5aH-dibenzofuran-9a-carboxylate |
|---|---|
| PubChem CID | 46217920 |
| Molecular Formula | C18H19BrO7 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | methyl (5aS,7S,9aR)-8-bromo-1-formyl-4-methoxy-7-(methoxymethoxy)-6,7-dihydro-5aH-dibenzofuran-9a-carboxylate |
| SMILES | COCO[C@H]1C[C@@H]2Oc3c(OC)ccc(C=O)c3[C@]2(C(=O)OC)C=C1Br |
| InChI | InChI=1S/C18H19BrO7/c1-22-9-25-13-6-14-18(7-11(13)19,17(21)24-3)15-10(8-20)4-5-12(23-2)16(15)26-14/h4-5,7-8,13-14H,6,9H2,1-3H3/t13-,14-,18-/m0/s1 |
| InChIKey | JMCHVCAMHNRQHR-DEYYWGMASA-N |
| XLogP | 2.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|