C25H33NO6 — CID 67605069
4-[[(4R,4aR,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butyl acetate (PubChem CID 67605069) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-[[(4R,4aR,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butyl acetate.
| Compound Name | 4-[[(4R,4aR,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butyl acetate |
|---|---|
| PubChem CID | 67605069 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 4-[[(4R,4aR,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butyl acetate |
| SMILES | COCOc1ccc2c3c1O[C@H]1C(OCCCCOC(C)=O)C=C[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C25H33NO6/c1-16(27)29-12-4-5-13-30-21-9-7-18-19-14-17-6-8-20(31-15-28-3)23-22(17)25(18,24(21)32-23)10-11-26(19)2/h6-9,18-19,21,24H,4-5,10-15H2,1-3H3/t18-,19+,21?,24-,25-/m0/s1 |
| InChIKey | HTDKQZBGCZUWOW-VEBAGZTGSA-N |
| XLogP | 2.84 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|