C24H31NO6 — CID 70301119
methyl 2-[[(4R,4aR,7S,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butanoate (PubChem CID 70301119) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is methyl 2-[[(4R,4aR,7S,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butanoate.
| Compound Name | methyl 2-[[(4R,4aR,7S,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butanoate |
|---|---|
| PubChem CID | 70301119 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | methyl 2-[[(4R,4aR,7S,7aR,12bS)-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]butanoate |
| SMILES | CCC(O[C@H]1C=C[C@H]2[C@H]3Cc4ccc(OCOC)c5c4[C@@]2(CCN3C)[C@H]1O5)C(=O)OC |
| InChI | InChI=1S/C24H31NO6/c1-5-17(23(26)28-4)30-19-9-7-15-16-12-14-6-8-18(29-13-27-3)21-20(14)24(15,22(19)31-21)10-11-25(16)2/h6-9,15-17,19,22H,5,10-13H2,1-4H3/t15-,16+,17?,19-,22-,24-/m0/s1 |
| InChIKey | JYLVEODLKCVYPR-CEJTUERFSA-N |
| XLogP | 2.45 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|