C25H33NO6 — CID 70304162
(4R,4aR,12bS)-7-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 70304162) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is (4R,4aR,12bS)-7-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aR,12bS)-7-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 70304162 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (4R,4aR,12bS)-7-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-9-(methoxymethoxy)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COCOc1ccc2c3c1OC1C(OC[C@@H]4COC(C)(C)O4)C=C[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C25H33NO6/c1-24(2)30-13-16(32-24)12-28-20-8-6-17-18-11-15-5-7-19(29-14-27-4)22-21(15)25(17,23(20)31-22)9-10-26(18)3/h5-8,16-18,20,23H,9-14H2,1-4H3/t16-,17+,18-,20?,23?,25+/m1/s1 |
| InChIKey | PMHVETCKFYVBIL-GYOBABLQSA-N |
| XLogP | 2.65 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|