C14H15O2Y- — CID 135041437
(4aS,9bS)-9b-methanidyl-6-methoxy-4,4a-dihydro-3H-dibenzofuran;yttrium (PubChem CID 135041437) has the molecular formula C14H15O2Y- and a molecular weight of 304.18 g/mol. Its IUPAC name is (4aS,9bS)-9b-methanidyl-6-methoxy-4,4a-dihydro-3H-dibenzofuran;yttrium.
| Compound Name | (4aS,9bS)-9b-methanidyl-6-methoxy-4,4a-dihydro-3H-dibenzofuran;yttrium |
|---|---|
| PubChem CID | 135041437 |
| Molecular Formula | C14H15O2Y- |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (4aS,9bS)-9b-methanidyl-6-methoxy-4,4a-dihydro-3H-dibenzofuran;yttrium |
| SMILES | [CH2-][C@@]12C=CCC[C@@H]1Oc1c(OC)cccc12.[Y] |
| InChI | InChI=1S/C14H15O2.Y/c1-14-9-4-3-8-12(14)16-13-10(14)6-5-7-11(13)15-2;/h4-7,9,12H,1,3,8H2,2H3;/q-1;/t12-,14-;/m0./s1 |
| InChIKey | HIXGXJUMZIKRIC-KYSPHBLOSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|