C26H44O3Si — CID 102346223
(1R,3Z,7Z,9R,10R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4,8,12-trimethyl-14-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one (PubChem CID 102346223) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (1R,3Z,7Z,9R,10R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4,8,12-trimethyl-14-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one.
| Compound Name | (1R,3Z,7Z,9R,10R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4,8,12-trimethyl-14-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one |
|---|---|
| PubChem CID | 102346223 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (1R,3Z,7Z,9R,10R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-4,8,12-trimethyl-14-prop-1-en-2-ylbicyclo[8.2.2]tetradeca-3,7-dien-11-one |
| SMILES | C=C(C)[C@H]1C[C@H]2C/C=C(/C)CC/C=C(/C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)[C@]2(C)O |
| InChI | InChI=1S/C26H44O3Si/c1-17(2)21-16-20-15-14-18(3)12-11-13-19(4)23(22(21)24(27)26(20,8)28)29-30(9,10)25(5,6)7/h13-14,20-23,28H,1,11-12,15-16H2,2-10H3/b18-14-,19-13-/t20-,21-,22-,23+,26-/m1/s1 |
| InChIKey | WEJWJYCEYAOBKF-KUUGDHHWSA-N |
| XLogP | 6.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|