C16H17ClN2O6 — CID 102346258
ethyl N-(6-chloro-7-methyl-4-oxochromen-3-yl)-N-(ethoxycarbonylamino)carbamate (PubChem CID 102346258) has the molecular formula C16H17ClN2O6 and a molecular weight of 368.77 g/mol. Its IUPAC name is ethyl N-(6-chloro-7-methyl-4-oxochromen-3-yl)-N-(ethoxycarbonylamino)carbamate.
| Compound Name | ethyl N-(6-chloro-7-methyl-4-oxochromen-3-yl)-N-(ethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102346258 |
| Molecular Formula | C16H17ClN2O6 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | ethyl N-(6-chloro-7-methyl-4-oxochromen-3-yl)-N-(ethoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)c1coc2cc(C)c(Cl)cc2c1=O |
| InChI | InChI=1S/C16H17ClN2O6/c1-4-23-15(21)18-19(16(22)24-5-2)12-8-25-13-6-9(3)11(17)7-10(13)14(12)20/h6-8H,4-5H2,1-3H3,(H,18,21) |
| InChIKey | RKQKHQKWPCKJRX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|