C72H92O4 — CID 102347035
9,10-bis[bis[4-[(2R)-octan-2-yl]oxyphenyl]methylidene]phenanthrene (PubChem CID 102347035) has the molecular formula C72H92O4 and a molecular weight of 1021.52 g/mol. Its IUPAC name is 9,10-bis[bis[4-[(2R)-octan-2-yl]oxyphenyl]methylidene]phenanthrene.
| Compound Name | 9,10-bis[bis[4-[(2R)-octan-2-yl]oxyphenyl]methylidene]phenanthrene |
|---|---|
| PubChem CID | 102347035 |
| Molecular Formula | C72H92O4 |
| Molecular Weight | 1021.52 g/mol |
| Exact Mass | 1020.70 |
| IUPAC Name | 9,10-bis[bis[4-[(2R)-octan-2-yl]oxyphenyl]methylidene]phenanthrene |
| SMILES | CCCCCC[C@@H](C)Oc1ccc(C(c2ccc(O[C@H](C)CCCCCC)cc2)=c2c(=C(c3ccc(O[C@H](C)CCCCCC)cc3)c3ccc(O[C@H](C)CCCCCC)cc3)c3ccccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C72H92O4/c1-9-13-17-21-29-53(5)73-61-45-37-57(38-46-61)69(58-39-47-62(48-40-58)74-54(6)30-22-18-14-10-2)71-67-35-27-25-33-65(67)66-34-26-28-36-68(66)72(71)70(59-41-49-63(50-42-59)75-55(7)31-23-19-15-11-3)60-43-51-64(52-44-60)76-56(8)32-24-20-16-12-4/h25-28,33-56H,9-24,29-32H2,1-8H3/t53-,54-,55-,56-/m1/s1 |
| InChIKey | FCPHCUFDXOCHAE-FQFJSIKISA-N |
| XLogP | 19.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.52 |
| LogP ≤ 5 | 19.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|