C17H11ClO2 — CID 102355241
(4-chlorophenyl)-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)methanone (PubChem CID 102355241) has the molecular formula C17H11ClO2 and a molecular weight of 282.73 g/mol. Its IUPAC name is (4-chlorophenyl)-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)methanone.
| Compound Name | (4-chlorophenyl)-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)methanone |
|---|---|
| PubChem CID | 102355241 |
| Molecular Formula | C17H11ClO2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (4-chlorophenyl)-(11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc2c(c1)C1C=CC2O1 |
| InChI | InChI=1S/C17H11ClO2/c18-12-4-1-10(2-5-12)17(19)11-3-6-13-14(9-11)16-8-7-15(13)20-16/h1-9,15-16H |
| InChIKey | UCOBYJWPCFPJKB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|