C17H14ClNO3 — CID 21287888
7-(4-chlorobenzoyl)-2,4-dimethyl-4H-1,2-benzoxazin-3-one (PubChem CID 21287888) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 7-(4-chlorobenzoyl)-2,4-dimethyl-4H-1,2-benzoxazin-3-one.
| Compound Name | 7-(4-chlorobenzoyl)-2,4-dimethyl-4H-1,2-benzoxazin-3-one |
|---|---|
| PubChem CID | 21287888 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 7-(4-chlorobenzoyl)-2,4-dimethyl-4H-1,2-benzoxazin-3-one |
| SMILES | CC1C(=O)N(C)Oc2cc(C(=O)c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C17H14ClNO3/c1-10-14-8-5-12(9-15(14)22-19(2)17(10)21)16(20)11-3-6-13(18)7-4-11/h3-10H,1-2H3 |
| InChIKey | KXIKAKAJCROKPR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |