2,2-bis(7-bromo-1H-indol-3-yl)acetic acid

C18H12Br2N2O2 — CID 102359653

IUPAC2,2-bis(7-bromo-1H-indol-3-yl)acetic acid
SMILESO=C(O)C(c1c[nH]c2c(Br)cccc12)c1c[nH]c2c(Br)cccc12
InChIInChI=1S/C18H12Br2N2O2/c19-13-5-1-3-9-11(7-21-16(9)13)15(18(23)24)12-8-22-17-10(12)4-2-6-14(17)20/h1-8,15,21-22H,(H,23,24)
InChIKeyKYPPPMJKNUJWLA-UHFFFAOYSA-N
MW448.11 g/mol
LogP5.39
Rot. Bonds3

About 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid

2,2-bis(7-bromo-1H-indol-3-yl)acetic acid (PubChem CID 102359653) has the molecular formula C18H12Br2N2O2 and a molecular weight of 448.11 g/mol. Its IUPAC name is 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid.

Molecular Properties

Compound Name2,2-bis(7-bromo-1H-indol-3-yl)acetic acid
PubChem CID102359653
Molecular FormulaC18H12Br2N2O2
Molecular Weight448.11 g/mol
Exact Mass445.93
IUPAC Name2,2-bis(7-bromo-1H-indol-3-yl)acetic acid
SMILESO=C(O)C(c1c[nH]c2c(Br)cccc12)c1c[nH]c2c(Br)cccc12
InChIInChI=1S/C18H12Br2N2O2/c19-13-5-1-3-9-11(7-21-16(9)13)15(18(23)24)12-8-22-17-10(12)4-2-6-14(17)20/h1-8,15,21-22H,(H,23,24)
InChIKeyKYPPPMJKNUJWLA-UHFFFAOYSA-N
XLogP5.39
TPSA68.88 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500448.11
LogP ≤ 55.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid?
The IUPAC name of 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid (CID 102359653) is 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid.
What is the SMILES notation for 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid?
The canonical SMILES for 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid is O=C(O)C(c1c[nH]c2c(Br)cccc12)c1c[nH]c2c(Br)cccc12.
What is the InChIKey of 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid?
The InChIKey is KYPPPMJKNUJWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Br2N2O2/c19-13-5-1-3-9-11(7-21-16(9)13)15(18(23)24)12-8-22-17-10(12)4-2-6-14(17)20/h1-8,15,21-22H,(H,23,24).
What are the key properties of 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid?
2,2-bis(7-bromo-1H-indol-3-yl)acetic acid has a molecular weight of 448.11 g/mol, XLogP of 5.39, 3 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(7-bromo-1H-indol-3-yl)acetic acid is sourced from PubChem (CID 102359653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).