C12H18O4 — CID 102360607
ethyl (2E,6E)-2-acetyloxyocta-2,6-dienoate (PubChem CID 102360607) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is ethyl (2E,6E)-2-acetyloxyocta-2,6-dienoate.
| Compound Name | ethyl (2E,6E)-2-acetyloxyocta-2,6-dienoate |
|---|---|
| PubChem CID | 102360607 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ethyl (2E,6E)-2-acetyloxyocta-2,6-dienoate |
| SMILES | C/C=C/CC/C=C(/OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C12H18O4/c1-4-6-7-8-9-11(16-10(3)13)12(14)15-5-2/h4,6,9H,5,7-8H2,1-3H3/b6-4+,11-9+ |
| InChIKey | HFXPWCATBVTFHI-HBWGMBCBSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|