C18H40O4Si2 — CID 102361488
methyl (4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate (PubChem CID 102361488) has the molecular formula C18H40O4Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is methyl (4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate.
| Compound Name | methyl (4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate |
|---|---|
| PubChem CID | 102361488 |
| Molecular Formula | C18H40O4Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | methyl (4S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate |
| SMILES | COC(=O)CC[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O4Si2/c1-17(2,3)23(8,9)21-14-15(12-13-16(19)20-7)22-24(10,11)18(4,5)6/h15H,12-14H2,1-11H3/t15-/m0/s1 |
| InChIKey | WGCSJJXTRCATOS-HNNXBMFYSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|