C27H34FN3O6S — CID 102363131
N-[(7S,10S,13S)-10-butan-2-yl-7-formyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),15,18-trien-13-yl]-4-fluorobenzenesulfonamide (PubChem CID 102363131) has the molecular formula C27H34FN3O6S and a molecular weight of 547.65 g/mol. Its IUPAC name is N-[(7S,10S,13S)-10-butan-2-yl-7-formyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),15,18-trien-13-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(7S,10S,13S)-10-butan-2-yl-7-formyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),15,18-trien-13-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 102363131 |
| Molecular Formula | C27H34FN3O6S |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | N-[(7S,10S,13S)-10-butan-2-yl-7-formyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),15,18-trien-13-yl]-4-fluorobenzenesulfonamide |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@@H](NS(=O)(=O)c2ccc(F)cc2)Cc2ccc(cc2)OCCCC[C@@H](C=O)NC1=O |
| InChI | InChI=1S/C27H34FN3O6S/c1-3-18(2)25-27(34)29-21(17-32)6-4-5-15-37-22-11-7-19(8-12-22)16-24(26(33)30-25)31-38(35,36)23-13-9-20(28)10-14-23/h7-14,17-18,21,24-25,31H,3-6,15-16H2,1-2H3,(H,29,34)(H,30,33)/t18?,21-,24-,25-/m0/s1 |
| InChIKey | XEUJJERXGFYNKU-XURZDYNYSA-N |
| XLogP | 2.49 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|