C14H18FN3 — CID 102365048
3-(7-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-amine (PubChem CID 102365048) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-(7-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-amine.
| Compound Name | 3-(7-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 102365048 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 3-(7-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)propan-1-amine |
| SMILES | NCCCC1NCCc2c1[nH]c1cc(F)ccc21 |
| InChI | InChI=1S/C14H18FN3/c15-9-3-4-10-11-5-7-17-12(2-1-6-16)14(11)18-13(10)8-9/h3-4,8,12,17-18H,1-2,5-7,16H2 |
| InChIKey | TYVCZDWRCPMKRG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|